C29H28N4O — CID 6024659
N-[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 6024659) has the molecular formula C29H28N4O and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 6024659 |
| Molecular Formula | C29H28N4O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-[(Z)-1-(4-cyclohexylphenyl)ethylideneamino]-2-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(-c2ccncc2)nc2ccccc12)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H28N4O/c1-20(21-11-13-23(14-12-21)22-7-3-2-4-8-22)32-33-29(34)26-19-28(24-15-17-30-18-16-24)31-27-10-6-5-9-25(26)27/h5-6,9-19,22H,2-4,7-8H2,1H3,(H,33,34)/b32-20- |
| InChIKey | PQRISSAAVFTDOS-RGXNXFOYSA-N |
| XLogP | 6.50 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|