C24H26N4O2 — CID 4167609
N-[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide (PubChem CID 4167609) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 4167609 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide |
| SMILES | CC(=NNC(=O)c1c[nH]c2ccccc12)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-16(27-28-24(30)21-15-25-22-10-6-5-9-20(21)22)17-11-13-19(14-12-17)26-23(29)18-7-3-2-4-8-18/h5-6,9-15,18,25H,2-4,7-8H2,1H3,(H,26,29)(H,28,30) |
| InChIKey | MDLWIXKZLGXDOG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|