C22H18N4O2S — CID 19685568
N-[(E)-1-[4-(thiophene-2-carbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide (PubChem CID 19685568) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[(E)-1-[4-(thiophene-2-carbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[(E)-1-[4-(thiophene-2-carbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 19685568 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[(E)-1-[4-(thiophene-2-carbonylamino)phenyl]ethylideneamino]-1H-indole-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1c[nH]c2ccccc12)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H18N4O2S/c1-14(25-26-21(27)18-13-23-19-6-3-2-5-17(18)19)15-8-10-16(11-9-15)24-22(28)20-7-4-12-29-20/h2-13,23H,1H3,(H,24,28)(H,26,27)/b25-14+ |
| InChIKey | DQSXLLOESYNJIW-AFUMVMLFSA-N |
| XLogP | 4.64 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|