C23H17ClN4OS — CID 3005269
1-(4-chlorophenyl)-3-[(2-phenylquinoline-4-carbonyl)amino]thiourea (PubChem CID 3005269) has the molecular formula C23H17ClN4OS and a molecular weight of 432.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2-phenylquinoline-4-carbonyl)amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2-phenylquinoline-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 3005269 |
| Molecular Formula | C23H17ClN4OS |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2-phenylquinoline-4-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(Cl)cc1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H17ClN4OS/c24-16-10-12-17(13-11-16)25-23(30)28-27-22(29)19-14-21(15-6-2-1-3-7-15)26-20-9-5-4-8-18(19)20/h1-14H,(H,27,29)(H2,25,28,30) |
| InChIKey | WPMSALVSBQFVIF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|