C23H16ClN5O3S — CID 171350748
1-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]-3-(4-nitrophenyl)thiourea (PubChem CID 171350748) has the molecular formula C23H16ClN5O3S and a molecular weight of 477.93 g/mol. Its IUPAC name is 1-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 171350748 |
| Molecular Formula | C23H16ClN5O3S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 1-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]-3-(4-nitrophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc([N+](=O)[O-])cc1)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C23H16ClN5O3S/c24-19-7-3-1-6-17(19)21-13-18(16-5-2-4-8-20(16)26-21)22(30)27-28-23(33)25-14-9-11-15(12-10-14)29(31)32/h1-13H,(H,27,30)(H2,25,28,33) |
| InChIKey | PVJVBMUAYVDRBV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|