C21H14ClN3O3 — CID 27020677
2-(2-chlorophenyl)-N'-(furan-3-carbonyl)quinoline-4-carbohydrazide (PubChem CID 27020677) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N'-(furan-3-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(2-chlorophenyl)-N'-(furan-3-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 27020677 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-(2-chlorophenyl)-N'-(furan-3-carbonyl)quinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12)c1ccoc1 |
| InChI | InChI=1S/C21H14ClN3O3/c22-17-7-3-1-6-15(17)19-11-16(14-5-2-4-8-18(14)23-19)21(27)25-24-20(26)13-9-10-28-12-13/h1-12H,(H,24,26)(H,25,27) |
| InChIKey | HNPQNFIKPFQLEI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|