C25H17ClN4O3S — CID 27690303
N'-[2-(2-chlorophenyl)quinoline-4-carbonyl]-3-oxo-4H-1,4-benzothiazine-6-carbohydrazide (PubChem CID 27690303) has the molecular formula C25H17ClN4O3S and a molecular weight of 488.96 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)quinoline-4-carbonyl]-3-oxo-4H-1,4-benzothiazine-6-carbohydrazide.
| Compound Name | N'-[2-(2-chlorophenyl)quinoline-4-carbonyl]-3-oxo-4H-1,4-benzothiazine-6-carbohydrazide |
|---|---|
| PubChem CID | 27690303 |
| Molecular Formula | C25H17ClN4O3S |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | N'-[2-(2-chlorophenyl)quinoline-4-carbonyl]-3-oxo-4H-1,4-benzothiazine-6-carbohydrazide |
| SMILES | O=C1CSc2ccc(C(=O)NNC(=O)c3cc(-c4ccccc4Cl)nc4ccccc34)cc2N1 |
| InChI | InChI=1S/C25H17ClN4O3S/c26-18-7-3-1-6-16(18)20-12-17(15-5-2-4-8-19(15)27-20)25(33)30-29-24(32)14-9-10-22-21(11-14)28-23(31)13-34-22/h1-12H,13H2,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | HBOVKWBLAGZORP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|