C22H14Cl2N4O2 — CID 46523882
2-(2-chlorophenyl)-N'-(2-chloropyridine-4-carbonyl)quinoline-4-carbohydrazide (PubChem CID 46523882) has the molecular formula C22H14Cl2N4O2 and a molecular weight of 437.29 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N'-(2-chloropyridine-4-carbonyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(2-chlorophenyl)-N'-(2-chloropyridine-4-carbonyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 46523882 |
| Molecular Formula | C22H14Cl2N4O2 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-(2-chlorophenyl)-N'-(2-chloropyridine-4-carbonyl)quinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2N4O2/c23-17-7-3-1-6-15(17)19-12-16(14-5-2-4-8-18(14)26-19)22(30)28-27-21(29)13-9-10-25-20(24)11-13/h1-12H,(H,27,29)(H,28,30) |
| InChIKey | RCRJVQJHCJJHSV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|