C21H13Cl2N5O2 — CID 4963799
N'-(5,6-dichloropyridine-3-carbonyl)-2-pyridin-2-ylquinoline-4-carbohydrazide (PubChem CID 4963799) has the molecular formula C21H13Cl2N5O2 and a molecular weight of 438.27 g/mol. Its IUPAC name is N'-(5,6-dichloropyridine-3-carbonyl)-2-pyridin-2-ylquinoline-4-carbohydrazide.
| Compound Name | N'-(5,6-dichloropyridine-3-carbonyl)-2-pyridin-2-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 4963799 |
| Molecular Formula | C21H13Cl2N5O2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N'-(5,6-dichloropyridine-3-carbonyl)-2-pyridin-2-ylquinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccn2)nc2ccccc12)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H13Cl2N5O2/c22-15-9-12(11-25-19(15)23)20(29)27-28-21(30)14-10-18(17-7-3-4-8-24-17)26-16-6-2-1-5-13(14)16/h1-11H,(H,27,29)(H,28,30) |
| InChIKey | GUOTXYWMGMIIBC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|