C13H8Cl2FN3O2 — CID 2087408
5,6-dichloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide (PubChem CID 2087408) has the molecular formula C13H8Cl2FN3O2 and a molecular weight of 328.13 g/mol. Its IUPAC name is 5,6-dichloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide.
| Compound Name | 5,6-dichloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 2087408 |
| Molecular Formula | C13H8Cl2FN3O2 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 5,6-dichloro-N'-(2-fluorobenzoyl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2FN3O2/c14-9-5-7(6-17-11(9)15)12(20)18-19-13(21)8-3-1-2-4-10(8)16/h1-6H,(H,18,20)(H,19,21) |
| InChIKey | NBCHGHLRNISDIK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|