C17H12ClFN4O2 — CID 49156531
1-(2-chlorophenyl)-N'-(2-fluorobenzoyl)pyrazole-4-carbohydrazide (PubChem CID 49156531) has the molecular formula C17H12ClFN4O2 and a molecular weight of 358.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N'-(2-fluorobenzoyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-(2-chlorophenyl)-N'-(2-fluorobenzoyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 49156531 |
| Molecular Formula | C17H12ClFN4O2 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-(2-chlorophenyl)-N'-(2-fluorobenzoyl)pyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1cnn(-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H12ClFN4O2/c18-13-6-2-4-8-15(13)23-10-11(9-20-23)16(24)21-22-17(25)12-5-1-3-7-14(12)19/h1-10H,(H,21,24)(H,22,25) |
| InChIKey | SYHFIEZZSBMCBY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|