C16H10F3N3O — CID 94828526
N-(3,5-difluorophenyl)-1-(2-fluorophenyl)pyrazole-4-carboxamide (PubChem CID 94828526) has the molecular formula C16H10F3N3O and a molecular weight of 317.27 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1-(2-fluorophenyl)pyrazole-4-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-1-(2-fluorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 94828526 |
| Molecular Formula | C16H10F3N3O |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-(3,5-difluorophenyl)-1-(2-fluorophenyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1cnn(-c2ccccc2F)c1 |
| InChI | InChI=1S/C16H10F3N3O/c17-11-5-12(18)7-13(6-11)21-16(23)10-8-20-22(9-10)15-4-2-1-3-14(15)19/h1-9H,(H,21,23) |
| InChIKey | CUOXTLWFHULUEC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |