C17H15FN4O3S — CID 95348121
1-(2-fluorophenyl)-N-[4-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide (PubChem CID 95348121) has the molecular formula C17H15FN4O3S and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[4-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[4-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 95348121 |
| Molecular Formula | C17H15FN4O3S |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[4-(methylsulfamoyl)phenyl]pyrazole-4-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)c2cnn(-c3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C17H15FN4O3S/c1-19-26(24,25)14-8-6-13(7-9-14)21-17(23)12-10-20-22(11-12)16-5-3-2-4-15(16)18/h2-11,19H,1H3,(H,21,23) |
| InChIKey | BMMVWSQHPLZALF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |