C18H17FN4O3S — CID 75526443
1-(2-fluorophenyl)-N-[1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide (PubChem CID 75526443) has the molecular formula C18H17FN4O3S and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75526443 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[1-(4-sulfamoylphenyl)ethyl]pyrazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cnn(-c2ccccc2F)c1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H17FN4O3S/c1-12(13-6-8-15(9-7-13)27(20,25)26)22-18(24)14-10-21-23(11-14)17-5-3-2-4-16(17)19/h2-12H,1H3,(H,22,24)(H2,20,25,26) |
| InChIKey | QBKZHTZBAOYFAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |