C21H21N3O5S2 — CID 2446305
4-(phenylsulfamoyl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 2446305) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-(phenylsulfamoyl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 4-(phenylsulfamoyl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 2446305 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 4-(phenylsulfamoyl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-15(16-7-11-19(12-8-16)30(22,26)27)23-21(25)17-9-13-20(14-10-17)31(28,29)24-18-5-3-2-4-6-18/h2-15,24H,1H3,(H,23,25)(H2,22,26,27)/t15-/m1/s1 |
| InChIKey | AHLBCPKNVXITFV-OAHLLOKOSA-N |
| XLogP | 2.63 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |