C11H11N3O3S2 — CID 141468396
N-[4-(methylsulfamoyl)phenyl]-1,2-thiazole-4-carboxamide (PubChem CID 141468396) has the molecular formula C11H11N3O3S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[4-(methylsulfamoyl)phenyl]-1,2-thiazole-4-carboxamide.
| Compound Name | N-[4-(methylsulfamoyl)phenyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 141468396 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-[4-(methylsulfamoyl)phenyl]-1,2-thiazole-4-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)c2cnsc2)cc1 |
| InChI | InChI=1S/C11H11N3O3S2/c1-12-19(16,17)10-4-2-9(3-5-10)14-11(15)8-6-13-18-7-8/h2-7,12H,1H3,(H,14,15) |
| InChIKey | PINRXZNCLAXBOW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |