C16H18ClN3O3S — CID 55826230
N-[3-chloro-4-(dimethylamino)phenyl]-4-(methylsulfamoyl)benzamide (PubChem CID 55826230) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-[3-chloro-4-(dimethylamino)phenyl]-4-(methylsulfamoyl)benzamide.
| Compound Name | N-[3-chloro-4-(dimethylamino)phenyl]-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55826230 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[3-chloro-4-(dimethylamino)phenyl]-4-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2ccc(N(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-18-24(22,23)13-7-4-11(5-8-13)16(21)19-12-6-9-15(20(2)3)14(17)10-12/h4-10,18H,1-3H3,(H,19,21) |
| InChIKey | UPNXGYZULDPQCK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|