C15H14N2O5S — CID 27648630
N-(1,3-benzodioxol-5-yl)-4-(methylsulfamoyl)benzamide (PubChem CID 27648630) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(methylsulfamoyl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 27648630 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H14N2O5S/c1-16-23(19,20)12-5-2-10(3-6-12)15(18)17-11-4-7-13-14(8-11)22-9-21-13/h2-8,16H,9H2,1H3,(H,17,18) |
| InChIKey | HKJLCGDGYMSKFE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |