C21H17N3O7S — CID 27648604
N-(1,3-benzodioxol-5-yl)-4-[(4-methyl-3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 27648604) has the molecular formula C21H17N3O7S and a molecular weight of 455.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-[(4-methyl-3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-[(4-methyl-3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 27648604 |
| Molecular Formula | C21H17N3O7S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-[(4-methyl-3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc4c(c3)OCO4)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O7S/c1-13-2-8-17(11-18(13)24(26)27)32(28,29)23-15-5-3-14(4-6-15)21(25)22-16-7-9-19-20(10-16)31-12-30-19/h2-11,23H,12H2,1H3,(H,22,25) |
| InChIKey | VOZFHMHKWGDLDI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|