C20H17N3O5S — CID 26576093
N-(4-methyl-3-nitrophenyl)-4-(phenylsulfamoyl)benzamide (PubChem CID 26576093) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is N-(4-methyl-3-nitrophenyl)-4-(phenylsulfamoyl)benzamide.
| Compound Name | N-(4-methyl-3-nitrophenyl)-4-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26576093 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-(4-methyl-3-nitrophenyl)-4-(phenylsulfamoyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(S(=O)(=O)Nc3ccccc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17N3O5S/c1-14-7-10-17(13-19(14)23(25)26)21-20(24)15-8-11-18(12-9-15)29(27,28)22-16-5-3-2-4-6-16/h2-13,22H,1H3,(H,21,24) |
| InChIKey | KPCJJTMSNJPOSG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|