C15H13N3O5 — CID 7406884
N-(1,3-benzodioxol-5-yl)-4-(methylamino)-3-nitrobenzamide (PubChem CID 7406884) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(methylamino)-3-nitrobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(methylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 7406884 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(methylamino)-3-nitrobenzamide |
| SMILES | CNc1ccc(C(=O)Nc2ccc3c(c2)OCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O5/c1-16-11-4-2-9(6-12(11)18(20)21)15(19)17-10-3-5-13-14(7-10)23-8-22-13/h2-7,16H,8H2,1H3,(H,17,19) |
| InChIKey | XNDALPYPTIMWPI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|