C18H14N4O5 — CID 26909123
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-imidazol-1-yl-3-nitrobenzamide (PubChem CID 26909123) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-imidazol-1-yl-3-nitrobenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-imidazol-1-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26909123 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-imidazol-1-yl-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O5/c23-18(20-13-2-4-16-17(10-13)27-8-7-26-16)12-1-3-14(15(9-12)22(24)25)21-6-5-19-11-21/h1-6,9-11H,7-8H2,(H,20,23) |
| InChIKey | BJPBHOOUZSUSEG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|