C23H17N5O6S — CID 58874521
N-[3-(benzenesulfonylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide (PubChem CID 58874521) has the molecular formula C23H17N5O6S and a molecular weight of 491.49 g/mol. Its IUPAC name is N-[3-(benzenesulfonylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide.
| Compound Name | N-[3-(benzenesulfonylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 58874521 |
| Molecular Formula | C23H17N5O6S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | N-[3-(benzenesulfonylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide |
| SMILES | O=C(Nc1cccc(C(=O)NS(=O)(=O)c2ccccc2)c1)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17N5O6S/c29-22(17-9-10-20(21(14-17)28(31)32)27-12-11-24-15-27)25-18-6-4-5-16(13-18)23(30)26-35(33,34)19-7-2-1-3-8-19/h1-15H,(H,25,29)(H,26,30) |
| InChIKey | GDVOPQZELCNDJH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|