C23H22ClN3O5S — CID 55821414
N-[3-chloro-4-(dimethylamino)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide (PubChem CID 55821414) has the molecular formula C23H22ClN3O5S and a molecular weight of 487.97 g/mol. Its IUPAC name is N-[3-chloro-4-(dimethylamino)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide.
| Compound Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55821414 |
| Molecular Formula | C23H22ClN3O5S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccc(NS(=O)(=O)c3ccc4c(c3)OCCO4)c2)cc1Cl |
| InChI | InChI=1S/C23H22ClN3O5S/c1-27(2)20-8-6-16(13-19(20)24)25-23(28)15-4-3-5-17(12-15)26-33(29,30)18-7-9-21-22(14-18)32-11-10-31-21/h3-9,12-14,26H,10-11H2,1-2H3,(H,25,28) |
| InChIKey | BURQCKRLPDQTCI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|