C21H17ClN2O5S — CID 4320437
4-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(phenylsulfamoyl)benzamide (PubChem CID 4320437) has the molecular formula C21H17ClN2O5S and a molecular weight of 444.90 g/mol. Its IUPAC name is 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(phenylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 4320437 |
| Molecular Formula | C21H17ClN2O5S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 4-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(phenylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccc(Cl)c(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C21H17ClN2O5S/c22-17-8-6-14(12-20(17)30(26,27)24-15-4-2-1-3-5-15)21(25)23-16-7-9-18-19(13-16)29-11-10-28-18/h1-9,12-13,24H,10-11H2,(H,23,25) |
| InChIKey | UKOYSJVZBHZXEY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |