C19H13ClF2N2O3S — CID 2304457
4-chloro-N-(3,4-difluorophenyl)-3-(phenylsulfamoyl)benzamide (PubChem CID 2304457) has the molecular formula C19H13ClF2N2O3S and a molecular weight of 422.84 g/mol. Its IUPAC name is 4-chloro-N-(3,4-difluorophenyl)-3-(phenylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-(3,4-difluorophenyl)-3-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2304457 |
| Molecular Formula | C19H13ClF2N2O3S |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 4-chloro-N-(3,4-difluorophenyl)-3-(phenylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C19H13ClF2N2O3S/c20-15-8-6-12(19(25)23-14-7-9-16(21)17(22)11-14)10-18(15)28(26,27)24-13-4-2-1-3-5-13/h1-11,24H,(H,23,25) |
| InChIKey | NYSVRUWYFNUZGE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |