C19H15Cl2N3O3S — CID 78838843
5-(anilinocarbamoyl)-2-chloro-N-(4-chlorophenyl)benzenesulfonamide (PubChem CID 78838843) has the molecular formula C19H15Cl2N3O3S and a molecular weight of 436.32 g/mol. Its IUPAC name is 5-(anilinocarbamoyl)-2-chloro-N-(4-chlorophenyl)benzenesulfonamide.
| Compound Name | 5-(anilinocarbamoyl)-2-chloro-N-(4-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 78838843 |
| Molecular Formula | C19H15Cl2N3O3S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 5-(anilinocarbamoyl)-2-chloro-N-(4-chlorophenyl)benzenesulfonamide |
| SMILES | O=C(NNc1ccccc1)c1ccc(Cl)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H15Cl2N3O3S/c20-14-7-9-16(10-8-14)24-28(26,27)18-12-13(6-11-17(18)21)19(25)23-22-15-4-2-1-3-5-15/h1-12,22,24H,(H,23,25) |
| InChIKey | DVCQVJTXVJSYPL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|