C19H11Cl3F2N2O3S — CID 21236808
4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]-N-(3,4-difluorophenyl)benzamide (PubChem CID 21236808) has the molecular formula C19H11Cl3F2N2O3S and a molecular weight of 491.73 g/mol. Its IUPAC name is 4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]-N-(3,4-difluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]-N-(3,4-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 21236808 |
| Molecular Formula | C19H11Cl3F2N2O3S |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | 4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]-N-(3,4-difluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C19H11Cl3F2N2O3S/c20-11-2-5-13(21)17(8-11)26-30(28,29)18-7-10(1-4-14(18)22)19(27)25-12-3-6-15(23)16(24)9-12/h1-9,26H,(H,25,27) |
| InChIKey | HMEXYBYMMWESRK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |