C21H16Cl2N2O6S — CID 4781795
N-(1,3-benzodioxol-5-yl)-3-[(2,5-dichlorophenyl)sulfamoyl]-4-methoxybenzamide (PubChem CID 4781795) has the molecular formula C21H16Cl2N2O6S and a molecular weight of 495.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[(2,5-dichlorophenyl)sulfamoyl]-4-methoxybenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[(2,5-dichlorophenyl)sulfamoyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4781795 |
| Molecular Formula | C21H16Cl2N2O6S |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[(2,5-dichlorophenyl)sulfamoyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)OCO3)cc1S(=O)(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O6S/c1-29-18-6-2-12(21(26)24-14-4-7-17-19(10-14)31-11-30-17)8-20(18)32(27,28)25-16-9-13(22)3-5-15(16)23/h2-10,25H,11H2,1H3,(H,24,26) |
| InChIKey | SKMGSQIVKRNIEA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |