C15H12ClNO4 — CID 775353
N-(5-chloro-2-methoxyphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 775353) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 775353 |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12ClNO4/c1-19-12-5-3-10(16)7-11(12)17-15(18)9-2-4-13-14(6-9)21-8-20-13/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | QNTLKXBMTZHKLO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |