C16H12ClNO6 — CID 45430005
4-(1,3-benzodioxole-5-carbonylamino)-5-chloro-2-methoxybenzoic acid (PubChem CID 45430005) has the molecular formula C16H12ClNO6 and a molecular weight of 349.73 g/mol. Its IUPAC name is 4-(1,3-benzodioxole-5-carbonylamino)-5-chloro-2-methoxybenzoic acid.
| Compound Name | 4-(1,3-benzodioxole-5-carbonylamino)-5-chloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 45430005 |
| Molecular Formula | C16H12ClNO6 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-(1,3-benzodioxole-5-carbonylamino)-5-chloro-2-methoxybenzoic acid |
| SMILES | COc1cc(NC(=O)c2ccc3c(c2)OCO3)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C16H12ClNO6/c1-22-13-6-11(10(17)5-9(13)16(20)21)18-15(19)8-2-3-12-14(4-8)24-7-23-12/h2-6H,7H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | DKGIADSRRCSCTG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |