C13H9Cl2NO4S — CID 43406221
5-chloro-4-[(5-chlorothiophene-2-carbonyl)amino]-2-methoxybenzoic acid (PubChem CID 43406221) has the molecular formula C13H9Cl2NO4S and a molecular weight of 346.19 g/mol. Its IUPAC name is 5-chloro-4-[(5-chlorothiophene-2-carbonyl)amino]-2-methoxybenzoic acid.
| Compound Name | 5-chloro-4-[(5-chlorothiophene-2-carbonyl)amino]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 43406221 |
| Molecular Formula | C13H9Cl2NO4S |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 5-chloro-4-[(5-chlorothiophene-2-carbonyl)amino]-2-methoxybenzoic acid |
| SMILES | COc1cc(NC(=O)c2ccc(Cl)s2)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C13H9Cl2NO4S/c1-20-9-5-8(7(14)4-6(9)13(18)19)16-12(17)10-2-3-11(15)21-10/h2-5H,1H3,(H,16,17)(H,18,19) |
| InChIKey | SSOFSUDFELLETB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |