C20H15Cl2N3O4S — CID 24640884
N-(4-carbamoylphenyl)-3-[(2,5-dichlorophenyl)sulfonylamino]benzamide (PubChem CID 24640884) has the molecular formula C20H15Cl2N3O4S and a molecular weight of 464.33 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-3-[(2,5-dichlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-(4-carbamoylphenyl)-3-[(2,5-dichlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 24640884 |
| Molecular Formula | C20H15Cl2N3O4S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | N-(4-carbamoylphenyl)-3-[(2,5-dichlorophenyl)sulfonylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2cccc(NS(=O)(=O)c3cc(Cl)ccc3Cl)c2)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O4S/c21-14-6-9-17(22)18(11-14)30(28,29)25-16-3-1-2-13(10-16)20(27)24-15-7-4-12(5-8-15)19(23)26/h1-11,25H,(H2,23,26)(H,24,27) |
| InChIKey | YLVAFYIOUXZDMB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |