C16H11Cl2N3O3S2 — CID 17477065
3-[(2,5-dichlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 17477065) has the molecular formula C16H11Cl2N3O3S2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[(2,5-dichlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 17477065 |
| Molecular Formula | C16H11Cl2N3O3S2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1cccc(NS(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3O3S2/c17-11-4-5-13(18)14(9-11)26(23,24)21-12-3-1-2-10(8-12)15(22)20-16-19-6-7-25-16/h1-9,21H,(H,19,20,22) |
| InChIKey | QLDLKOMMLCPXLT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |