C22H16ClN3O3S2 — CID 24648789
3-[(3-chlorophenyl)sulfamoyl]-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide (PubChem CID 24648789) has the molecular formula C22H16ClN3O3S2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)sulfamoyl]-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide.
| Compound Name | 3-[(3-chlorophenyl)sulfamoyl]-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 24648789 |
| Molecular Formula | C22H16ClN3O3S2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 3-[(3-chlorophenyl)sulfamoyl]-N-[4-(1,3-thiazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nccs2)cc1)c1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C22H16ClN3O3S2/c23-17-4-2-5-19(14-17)26-31(28,29)20-6-1-3-16(13-20)21(27)25-18-9-7-15(8-10-18)22-24-11-12-30-22/h1-14,26H,(H,25,27) |
| InChIKey | QFZZRLQHPOMJOW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |