C20H15N3O3S3 — CID 55991234
N-[3-(1,3-thiazol-2-yl)phenyl]-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55991234) has the molecular formula C20H15N3O3S3 and a molecular weight of 441.56 g/mol. Its IUPAC name is N-[3-(1,3-thiazol-2-yl)phenyl]-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[3-(1,3-thiazol-2-yl)phenyl]-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55991234 |
| Molecular Formula | C20H15N3O3S3 |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | N-[3-(1,3-thiazol-2-yl)phenyl]-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1cccc(-c2nccs2)c1)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H15N3O3S3/c24-19(22-16-6-2-5-15(13-16)20-21-9-11-28-20)14-4-1-7-17(12-14)23-29(25,26)18-8-3-10-27-18/h1-13,23H,(H,22,24) |
| InChIKey | VDPVVPCZWDBPMY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |