C19H15N5O3S2 — CID 55829891
N-(6-imidazol-1-yl-3-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55829891) has the molecular formula C19H15N5O3S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-(6-imidazol-1-yl-3-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(6-imidazol-1-yl-3-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55829891 |
| Molecular Formula | C19H15N5O3S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-(6-imidazol-1-yl-3-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1ccc(-n2ccnc2)nc1)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H15N5O3S2/c25-19(22-16-6-7-17(21-12-16)24-9-8-20-13-24)14-3-1-4-15(11-14)23-29(26,27)18-5-2-10-28-18/h1-13,23H,(H,22,25) |
| InChIKey | WHOIZLQQPACRGO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |