C11H9N5O2S2 — CID 121135238
N-(6-imidazol-1-ylpyrimidin-4-yl)thiophene-2-sulfonamide (PubChem CID 121135238) has the molecular formula C11H9N5O2S2 and a molecular weight of 307.36 g/mol. Its IUPAC name is N-(6-imidazol-1-ylpyrimidin-4-yl)thiophene-2-sulfonamide.
| Compound Name | N-(6-imidazol-1-ylpyrimidin-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 121135238 |
| Molecular Formula | C11H9N5O2S2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-(6-imidazol-1-ylpyrimidin-4-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(-n2ccnc2)ncn1)c1cccs1 |
| InChI | InChI=1S/C11H9N5O2S2/c17-20(18,11-2-1-5-19-11)15-9-6-10(14-7-13-9)16-4-3-12-8-16/h1-8H,(H,13,14,15) |
| InChIKey | SYXSRZVPVFBVPH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |