C15H12ClN3O2S2 — CID 113033430
N-[5-(4-chloroanilino)-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113033430) has the molecular formula C15H12ClN3O2S2 and a molecular weight of 365.87 g/mol. Its IUPAC name is N-[5-(4-chloroanilino)-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[5-(4-chloroanilino)-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113033430 |
| Molecular Formula | C15H12ClN3O2S2 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-[5-(4-chloroanilino)-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2ccc(Cl)cc2)cn1)c1cccs1 |
| InChI | InChI=1S/C15H12ClN3O2S2/c16-11-3-5-12(6-4-11)18-13-7-8-14(17-10-13)19-23(20,21)15-2-1-9-22-15/h1-10,18H,(H,17,19) |
| InChIKey | HCRBQOKONSJODX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |