C17H17N3O2S2 — CID 113017131
N-[6-(3,5-dimethylanilino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113017131) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is N-[6-(3,5-dimethylanilino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(3,5-dimethylanilino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113017131 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[6-(3,5-dimethylanilino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(C)cc(Nc2ccc(NS(=O)(=O)c3cccs3)cn2)c1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-12-8-13(2)10-15(9-12)19-16-6-5-14(11-18-16)20-24(21,22)17-4-3-7-23-17/h3-11,20H,1-2H3,(H,18,19) |
| InChIKey | ZHDSIXUJLXWEKS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |