C15H11ClFN3O2S2 — CID 113019023
N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113019023) has the molecular formula C15H11ClFN3O2S2 and a molecular weight of 383.86 g/mol. Its IUPAC name is N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113019023 |
| Molecular Formula | C15H11ClFN3O2S2 |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-[6-(3-chloro-4-fluoroanilino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2ccc(F)c(Cl)c2)nc1)c1cccs1 |
| InChI | InChI=1S/C15H11ClFN3O2S2/c16-12-8-10(3-5-13(12)17)19-14-6-4-11(9-18-14)20-24(21,22)15-2-1-7-23-15/h1-9,20H,(H,18,19) |
| InChIKey | BRDKQTRGTGHARC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |