C16H14ClN3O2S2 — CID 113018953
N-[6-(3-chloro-4-methylanilino)-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113018953) has the molecular formula C16H14ClN3O2S2 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[6-(3-chloro-4-methylanilino)-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-(3-chloro-4-methylanilino)-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113018953 |
| Molecular Formula | C16H14ClN3O2S2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N-[6-(3-chloro-4-methylanilino)-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(Nc2ccc(NS(=O)(=O)c3cccs3)cn2)cc1Cl |
| InChI | InChI=1S/C16H14ClN3O2S2/c1-11-4-5-12(9-14(11)17)19-15-7-6-13(10-18-15)20-24(21,22)16-3-2-8-23-16/h2-10,20H,1H3,(H,18,19) |
| InChIKey | STULEHGZBGXBSN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |