C18H18N2O2S2 — CID 112986376
N-[4-(3,4-dimethylanilino)phenyl]thiophene-2-sulfonamide (PubChem CID 112986376) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[4-(3,4-dimethylanilino)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-(3,4-dimethylanilino)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112986376 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-[4-(3,4-dimethylanilino)phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(Nc2ccc(NS(=O)(=O)c3cccs3)cc2)cc1C |
| InChI | InChI=1S/C18H18N2O2S2/c1-13-5-6-17(12-14(13)2)19-15-7-9-16(10-8-15)20-24(21,22)18-4-3-11-23-18/h3-12,19-20H,1-2H3 |
| InChIKey | HDDOTLWWWUJEFU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |