C12H11NO4S2 — CID 56828335
2-methyl-4-(thiophen-2-ylsulfonylamino)benzoic acid (PubChem CID 56828335) has the molecular formula C12H11NO4S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-methyl-4-(thiophen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 2-methyl-4-(thiophen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 56828335 |
| Molecular Formula | C12H11NO4S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-methyl-4-(thiophen-2-ylsulfonylamino)benzoic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2cccs2)ccc1C(=O)O |
| InChI | InChI=1S/C12H11NO4S2/c1-8-7-9(4-5-10(8)12(14)15)13-19(16,17)11-3-2-6-18-11/h2-7,13H,1H3,(H,14,15) |
| InChIKey | MFEBMPPOADCRRB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |