C16H20N2O4S2 — CID 78867915
2-hydroxy-N-pentan-3-yl-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 78867915) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-hydroxy-N-pentan-3-yl-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | 2-hydroxy-N-pentan-3-yl-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 78867915 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-hydroxy-N-pentan-3-yl-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CCC(CC)NC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1O |
| InChI | InChI=1S/C16H20N2O4S2/c1-3-11(4-2)17-16(20)13-8-7-12(10-14(13)19)18-24(21,22)15-6-5-9-23-15/h5-11,18-19H,3-4H2,1-2H3,(H,17,20) |
| InChIKey | SHWBQEYBBWFNAT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |