C21H20N2O4S2 — CID 78869372
N-[cyclopropyl(phenyl)methyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 78869372) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[cyclopropyl(phenyl)methyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[cyclopropyl(phenyl)methyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 78869372 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[cyclopropyl(phenyl)methyl]-2-hydroxy-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NC(c1ccccc1)C1CC1)c1ccc(NS(=O)(=O)c2cccs2)cc1O |
| InChI | InChI=1S/C21H20N2O4S2/c24-18-13-16(23-29(26,27)19-7-4-12-28-19)10-11-17(18)21(25)22-20(15-8-9-15)14-5-2-1-3-6-14/h1-7,10-13,15,20,23-24H,8-9H2,(H,22,25) |
| InChIKey | SACMPHNVOCGONW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |