C21H19FN2O4S2 — CID 78869056
N-[4-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-3-hydroxyphenyl]thiophene-2-sulfonamide (PubChem CID 78869056) has the molecular formula C21H19FN2O4S2 and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[4-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-3-hydroxyphenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-3-hydroxyphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 78869056 |
| Molecular Formula | C21H19FN2O4S2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[4-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-3-hydroxyphenyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccs2)cc1O)N1CCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O4S2/c22-15-7-5-14(6-8-15)18-3-1-11-24(18)21(26)17-10-9-16(13-19(17)25)23-30(27,28)20-4-2-12-29-20/h2,4-10,12-13,18,23,25H,1,3,11H2 |
| InChIKey | KCSMWRMHSYTARH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |