C19H20FNO2 — CID 70744880
[2-(4-fluorophenyl)piperidin-1-yl]-(3-hydroxy-2-methylphenyl)methanone (PubChem CID 70744880) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is [2-(4-fluorophenyl)piperidin-1-yl]-(3-hydroxy-2-methylphenyl)methanone.
| Compound Name | [2-(4-fluorophenyl)piperidin-1-yl]-(3-hydroxy-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 70744880 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [2-(4-fluorophenyl)piperidin-1-yl]-(3-hydroxy-2-methylphenyl)methanone |
| SMILES | Cc1c(O)cccc1C(=O)N1CCCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO2/c1-13-16(5-4-7-18(13)22)19(23)21-12-3-2-6-17(21)14-8-10-15(20)11-9-14/h4-5,7-11,17,22H,2-3,6,12H2,1H3 |
| InChIKey | CWVVWBLJVNKKLV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |