C17H19N3O — CID 43575481
(3-amino-2-methylphenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 43575481) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (3-amino-2-methylphenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3-amino-2-methylphenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 43575481 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (3-amino-2-methylphenyl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | Cc1c(N)cccc1C(=O)N1CCCC1c1ccncc1 |
| InChI | InChI=1S/C17H19N3O/c1-12-14(4-2-5-15(12)18)17(21)20-11-3-6-16(20)13-7-9-19-10-8-13/h2,4-5,7-10,16H,3,6,11,18H2,1H3 |
| InChIKey | FWMXGJPMAANBKS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|