C20H23NO3 — CID 102555243
(2-hydroxy-3-methoxyphenyl)-(2-phenylazepan-1-yl)methanone (PubChem CID 102555243) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2-hydroxy-3-methoxyphenyl)-(2-phenylazepan-1-yl)methanone.
| Compound Name | (2-hydroxy-3-methoxyphenyl)-(2-phenylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 102555243 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (2-hydroxy-3-methoxyphenyl)-(2-phenylazepan-1-yl)methanone |
| SMILES | COc1cccc(C(=O)N2CCCCCC2c2ccccc2)c1O |
| InChI | InChI=1S/C20H23NO3/c1-24-18-13-8-11-16(19(18)22)20(23)21-14-7-3-6-12-17(21)15-9-4-2-5-10-15/h2,4-5,8-11,13,17,22H,3,6-7,12,14H2,1H3 |
| InChIKey | RHYLZNMFRSRZNO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |